Bubuk Urolithin B

November 9, 2020

Cofttek mangrupikeun pabrik bubuk Urolithin B pangsaéna di Cina. Pabrik urang gaduh sistem manajemen produksi anu lengkep (ISO9001 & ISO14001), kalayan kapasitas produksi bulanan 200kg.

 


status: Dina Massa Produksi
unit: 1kg / kantong, 25kg / Dram

Urolithin BSpecifications

ngaran: Urolithin B
Ngaran kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula Kimia: C13H8O3
Beurat molekul: 212.2 g / mol
warna:  bubuk bodas
Konci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kodeu SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
fungsi: Urolithin B tiasa ningkatkeun mitochondrial sareng fungsi otot.

Urolithin B tiasa ningkatkeun kakuatan otot sareng daya tahan salami sepuh.

aplikasi: Urolithin B mangrupikeun métabolit mikroba peujit tina ellagitannis sareng nunjukkeun aktivasina anti-oksidan sareng pro-oksidan gumantung kana sistem dasiatan na kaseueus. Urolithin B ogé tiasa ningalikeun kagiatan estrogenik sareng / atanapi kagiatan anti estrogenik.
kaleyuran: Gampang leyur dina N, N-dimethylformamide sareng dimethylmethylene. Sulfone, rada larut dina métanol, étanol, sareng étil acétat
Temp neundeun: Hygroscopic, -20 ° C freezer, Dina atmosfir mulya
Kaayaan Pengiriman: Shipped handapeun hawa ambient sakumaha kimia non-picilakaeun. produk ieu cukup keur sababaraha minggu stabil salila pengiriman barang biasa na waktos spent di Adat istiadat.

 

Urolithin B Spéktrum NMR

Urolithin B (1139-83-9) - NMR Spéktrum

 

Upami anjeun peryogi COA, MSDS, HNMR pikeun unggal batch produk sareng inpormasi sanés, mangga ngahubungan kami manajer pamasaran.

 

Perkenalan ka Urolithins

Urolithins mangrupikeun metabolit sekunder tina asam ellagic anu diturunkeun tina ellagitannins. Dina manusa ellagitannins dirobah ku microflora usus kana asam ellagic anu salajengna dirobih janten urolithins A, urolithin B, urolithin C sareng urolithin D dina peujit ageung.

Urolithin A (UA) nyaéta métabolit anu paling nyebar tina ellagitannins. Nanging, urolithin A henteu dipikaterang kajadian sacara alami dina sumber diet.

Urolithin B (UB) nyaéta hiji métabolit anu réa dihasilkeun dina peujit ngalangkungan transformasi ellagitannins. Urolithin B mangrupikeun produk terakhir saatos sadayana turunan urolithin sanés katépat. Urolithin B aya dina cikiih salaku urolithin B glukuronida.

Urolithin 8-Methyl Ether mangrupikeun produk panengah nalika sintésis Urolithin A. Mangrupikeun metabolit sekunder anu signifikan tina ellagitannin sareng ngagaduhan sipat antioksidan sareng anti radang.

 

Mékanisme tindakan urolithin A sareng B

● Urolithin A nyababkeun mitofagy

Mitophagy mangrupikeun salah sahiji bentuk autofagy anu ngabantosan ngaleungitkeun mitokondria anu ruksak pikeun fungsina anu optimal. Autophagy ngarujuk kana prosés umum dimana eusi sitoplasmik diturunkeun sareng akibatna didaur ulang sedengkeun mitophagy nyaéta degradasi sareng daur ulang tina mitokondria.

Salila sepuh panurunan dina autofagy mangrupikeun hiji aspék anu nyababkeun turunna fungsi mitokondria. Salajengna, setrés oksidatif ogé tiasa ngakibatkeun autophagy low. Urolithin A ngagaduhan kamampuan ngaleungitkeun mitokondria rusak liwat autophagy selektif.

● Pasipatan antioksidan

Setrés oksidatif lumangsung nalika teu aya saimbangna antara radikal bébas sareng antioksidan dina awak. Lebihan ieu radikal bébas anu sering dipatalikeun sareng seueur panyakit kronis sapertos gangguan jantung, diabetes sareng kanker.

Urolithins A sareng B nunjukkeun épék antioksidan ku kamampuan pikeun ngirangan radikal bébas sareng tingkat spésiés réaktif oksigén (ROS) intracellular sareng ogé ngahambat peroksidaan lipid dina sababaraha sél sél.

Salajengna, urolithins tiasa ngahambat sababaraha énzim pangoksidasi, kalebet monoamine oxidase A sareng tyrosinase.

● Pasipatan anti radang

Peradangan mangrupikeun prosés alamiah dimana awak urang merjuangkeun naon waé anu murag sapertos inféksi, cilaka, sareng mikroba. Nanging, peradangan kronis tiasa ngabahayakeun awak sabab ieu dikaitkeun sareng sababaraha gangguan sapertos asma, masalah jantung, sareng kanker. Peradangan kronis tiasa janten akibat peradangan akut anu teu diubaran, inféksi atanapi bahkan radikal bébas dina awak.

Urolithins A sareng B nunjukkeun sipat anti-peradangan ku ngahambat produksi oksida nitrat. Aranjeunna sacara khusus ngahambat nitrat oxic synthase (iNOS) protéin sareng ekspresi mRNA anu tanggung jawab radang.

● Pangaruh anti mikroba

Mikroba kaasup baktéri, jamur sareng virus lumangsung sacara alami di lingkunganana komo dina awak manusa. Tapi, sababaraha mikroba anu dirujuk ku patogen tiasa nyababkeun panyakit inféksi sapertos flu, campak sareng malaria.

Urolithin A sareng B tiasa nunjukkeun kagiatan antimikrobial ku ngahambat ku sensing. Sensing korum mangrupikeun modeu komunikasi baktéri anu ngamungkinkeun baktéri ngadeteksi sareng ngontrol prosés anu aya hubunganna sapertos virulence sareng motility.

● ngahambat glikasi protéin

Glikasi ngarujuk kana gagantel non-énzimatik gula kana lipid atanapi protéin. Éta mangrupikeun biomarker konci dina diabetes sareng gangguan anu sanés ogé sepuh.

Glikogén protéin anu luhur mangrupikeun pangaruh sekundér tina hyperglycemia ngagaduhan peran utama dina gangguan anu aya hubunganana kayaning diabetes sareng panyakit Alzheimer.

Urolithin A sareng B gaduh sipat anti-glikatif anu gumantung kana dosis anu mandiri tina kagiatan antioksidan.

 

Mangpaat Urolithin B

Suplemén Urolithin B ogé ngagaduhan sababaraha manpaat kaséhatan sareng seuseueurna mirip sareng kauntungan urolithin A.

(1) Poténsi anti kanker
Sipat anti radang tina urolithin B ngajadikeun éta calon anu hadé pikeun ngalawan kanker. Sababaraha peneliti ngalaporkeun poténsi ieu di fibroblasts, mikrofag sareng sél endothelial.

Panaliti ngalaporkeun yén UB ngahambat sababaraha jinis kanker sapertos prostat, usus besar sareng kanker kandung kemih.

Dina ulikan anu ngalibatkeun sél kanker usus manusa, ellagitannins, asam ellagic sareng urolithins A sareng B dievaluasi pikeun poténsi anti kanker maranéhna. Aranjeunna ngalaporkeun yén sagala perlakuan tiasa ngahambat kamekaran sél kanker. Aranjeunna ngahambat sél kanker proliferasi ngalangkungan siklus sél dina fase anu béda sareng ogé ku mendorong apoptosis.

(2) Bisa ngabantosan ngalawan stres oksidatif
Urolithin B ngagaduhan sipat antioksidan anu hadé ngalangkungan tingkat spésiés oksigén réaktif sareng peroksidasi lipid dina jinis sél anu tangtu. Tingkat luhur ROS pakait sareng seueur gangguan sapertos panyawat Alzheimer.

Dina hiji ulikan sél sélonal anu kakeunaan setrés oksidatif, suplemén urolithin B ogé urolithin A kapanggih pikeun ngajaga sél ngalawan oksidasi ku kituna ningkat sél survival sél.

(3) Urolithin B dina ningkat mémori
Urolithin b dilaporkeun pikeun ningkatkeun perméabilitas getih-halangan. Ieu ningkatkeun fungsi kognitif.

Panaliti nunjukkeun yén urolithin B tiasa janten paningkatan mémori paningkatan ku ningkatkeun fungsi kognitif sacara umum.

(4) Nyegah leungitna otot
Rugi otot bisa lumangsung kusabab sagala rupa alesan sapertos gangguan, sepuh sareng kakurangan protéin dina dahareun. Sababaraha ukuran pikeun ngeureunkeun, ngabatesan atanapi langkung saé nyegah karugian otot diantarana, latihan, ubar sareng asam amino ogé polyphenol tiasa padamelan.

Urolithins bisa diklasifikasikeun salaku polyphenols sareng maénkeun peran pikeun ngahalangan rugi otot ku ngaktifkeun sintésis protéin otot sareng ngalambatkeun ogé ngahinakeun.

Dina hiji ulikan sareng beurit, suplemén Urolithin B dikaluarkeun salami waktos dipanggihan pikeun ningkatkeun kamampuan otot na salaku otot katingali langkung ageung.

(5) Urolithin B merangan peradangan
Urolithin B gaduh pasipatan anti radang ku ngirangan ku spidol peradangan.

Dina ulikan beurit kalayan fibrosis ginjal ngainduksi, urolithin B kapanggih pikeun ngiringan tatu ginjal. Éta ningkatkeun fungsi ginjal, morfologi ginjal ogé ngirangan spidol tatu ginjal. Ieu nunjukkeun yén UB tiasa ngirangan radang ginjal.

(6) Mangpaat sinergis urolithin A sareng B
Épék sinergis ogé parantos dilaporkeun dina kombinasi urolithin A sareng B dina fungsi kognitif sareng kapasitas. Panilitian nyatakeun yén kombinasi ieu tiasa dianggo dina ngarawat atanapi nyegah gangguan anu aya hubunganana sareng pikun sapertos kahariwang atanapi gangguan Alzheimer.

Manfaat sejenna anu aya hubunganana sareng urolithins nyaéta;

  • neuroprotection
  • Sindrom métabolik ameliorates

 

Urolithin A sareng sumber sumber B

Urolithins henteu kapendak janten alami sacara alami di sumber-sumber diet. Éta mangrupikeun produk tina transformasi asam ellagic anu diturunkeun tina ellagitannins. Ellagitannins dirobih jadi asam ellagic ku microbiota usus sareng asam ellagic salajengna dirobih kana métabolitna (urolithins) dina peujit badag.

Ellagitannins alami sacara alami dina sumber kadaharan sapertos dalima, buah kaasup strawberry, raspberry, cloudberry sareng blackberry, anggur muscadine, almond, jambu batu, téh, sareng kacang sapertos walnuts sareng chestnuts ogé inuman anu umurna kayak sapertos anggur beureum sareng wiski ti tong ek.

Maka urang tiasa nyimpulkeun tuangeun urolithin A sareng pangan urolithin B mangrupikeun tuangeun anu seueur ellagitannin. Perhatoskeun yén bioavailabilitas ellagitannin kawates pisan sedengkeun metabolit sekunder na (urolithins) gampang dipasihan bioavailable.

Ékskrési sareng produksi urolithins bénten-bénten sapertos di jalma-jalma kumargi konversi ti ellagitannins ngandelkeun microbiota dina peujit. Aya baktéri khusus anu kalibet dina konvérsi ieu sareng bénten-bénten di antara individu dimana sababaraha gaduh mikrobiota anu pantes, rendah atanapi henteu sayogi. Sumber pangan ogé bénten-bénten dina tingkat ellagitannins na. Maka kauntungan poténsial ellagitannins beda-beda ti hiji individu ka anu sanés.

 

Suplemén Urolithin A sareng B

Suplemén Urolithin A ogé suplemén Urolithin B gampang dipendakan di pasar salaku suplemén sumber kadaharan anu euyeub ku ellagitannin. Suplemén Urolithin A ogé sayogi sayogi. Seuseueurna suplemen dalima parantos seueur dijual sareng dianggo kalayan suksés. Suplemén ieu disintésis tina buah atanapi kacang sareng dirumuskeun kana bentuk cair atanapi bubuk.

Kusabab variasi konsentrasi ellagitannins dina béda pangan, konsumén urolithin a mésér éta mertimbangkeun sumber pangan. Hal anu sami diterapkeun nalika sumber pikeun bubuk urolithin B atanapi suplemén cair.

Sababaraha studi klinis manusa dilakukeun sareng bubuk urolithin A atanapi B henteu ngalaporkeun efek samping serius ti administrasi suplemén ieu.

rujukan

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). "Nasib metabolik tina Ellagitannins: implikasi pikeun Kaséhatan, sareng Perspéktif Panilitian pikeun Pangan Fungsional Inovatif". Ulasan Kritik dina Élmu Pangan sareng Nutrisi.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 November 2009). "Urolithins, metabolit mikroba usus tina ellagitannins Dalima, paméran kagiatan antioksidan anu kuat dina uji coba sél". J Agric Dahareun Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). "Sintésis Éléktron-Permintaan Divers-Alder Total Total Sintésis Urolithin M7".