Urolithin B (1139-83-9) Pabrik pabrik

Urolithin B

November 9, 2020

Urolithin BSpecifications

ngaran: Urolithin B
Ngaran kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula Kimia: C13H8O3
Beurat molekul: 212.2 g / mol
warna:  bubuk bodas
Konci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kodeu SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
fungsi: Urolithin B tiasa ningkatkeun mitochondrial sareng fungsi otot.

Urolithin B tiasa ningkatkeun kakuatan otot sareng daya tahan salami sepuh.

aplikasi: Urolithin B mangrupikeun métabolit mikroba peujit tina ellagitannis sareng nunjukkeun aktivasina anti-oksidan sareng pro-oksidan gumantung kana sistem dasiatan na kaseueus. Urolithin B ogé tiasa ningalikeun kagiatan estrogenik sareng / atanapi kagiatan anti estrogenik.
kaleyuran: Gampang leyur dina N, N-dimethylformamide sareng dimethylmethylene. Sulfone, rada larut dina métanol, étanol, sareng étil acétat
Temp neundeun: Hygroscopic, -20 ° C freezer, Dina atmosfir mulya
Kaayaan Pengiriman: Shipped handapeun hawa ambient sakumaha kimia non-picilakaeun. produk ieu cukup keur sababaraha minggu stabil salila pengiriman barang biasa na waktos spent di Adat istiadat.